Spaces:
Sleeping
Sleeping
File size: 22,979 Bytes
dcacefd | 1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46 47 48 49 50 51 52 53 54 55 56 57 58 59 60 61 62 63 64 65 66 67 68 69 70 71 72 73 74 75 76 77 78 79 80 81 82 83 84 85 86 87 88 89 90 91 92 93 94 95 96 97 98 99 100 101 102 103 104 105 106 107 108 109 110 111 112 113 114 115 116 117 118 119 120 121 122 123 124 125 126 127 128 129 130 131 132 133 134 135 136 137 138 139 140 141 142 143 144 145 146 147 148 149 150 151 152 153 154 155 156 157 158 159 160 161 162 163 164 165 166 167 168 169 170 171 172 173 174 175 176 177 178 179 180 181 182 183 184 185 186 187 188 189 190 191 192 193 194 195 196 197 198 199 200 201 202 203 204 205 206 207 208 209 210 211 212 213 214 215 216 217 218 219 220 221 222 223 224 225 226 227 228 229 230 231 232 233 234 235 236 237 238 239 240 241 242 243 244 245 246 247 248 249 250 251 252 253 254 255 256 257 258 259 260 261 262 263 264 265 266 267 268 269 270 271 272 273 274 275 276 277 278 279 280 281 282 283 284 285 286 287 288 289 290 291 292 293 294 295 296 297 298 299 300 301 302 303 304 305 306 307 308 309 310 311 312 313 314 315 316 317 318 319 320 321 322 323 324 325 326 327 328 329 330 331 332 333 334 335 336 337 338 339 340 341 342 343 344 345 346 347 348 349 350 351 352 353 354 355 356 357 358 359 360 361 362 363 364 365 366 367 368 369 370 371 372 373 374 375 376 377 378 379 380 381 382 383 384 385 386 387 388 389 390 391 392 393 394 395 396 397 398 399 400 401 402 403 404 405 406 407 408 409 410 411 412 413 414 415 416 417 418 419 420 421 422 423 424 425 426 427 428 429 430 431 432 433 434 435 436 437 438 439 440 441 442 443 444 445 446 447 448 449 450 451 452 453 454 455 456 457 458 459 460 461 462 463 464 465 466 467 468 469 470 471 472 473 474 475 476 477 478 479 480 481 482 483 484 485 486 487 488 489 490 491 492 493 494 495 496 497 498 499 500 501 502 503 504 505 506 507 508 509 510 511 512 513 514 515 516 517 518 519 520 521 522 523 524 525 526 527 528 529 530 531 532 533 534 535 536 537 538 539 540 541 542 543 544 545 546 547 548 549 550 551 552 553 554 555 556 557 558 559 560 561 562 563 564 565 566 567 568 569 570 571 572 573 574 575 576 577 578 579 580 581 582 583 584 585 586 587 588 589 590 591 592 593 594 595 596 597 598 599 600 601 602 603 604 605 606 607 608 609 610 611 612 613 614 615 616 617 618 619 620 621 622 623 624 625 626 627 628 629 630 631 632 633 634 635 636 637 638 639 640 641 642 | import rdkit
import rdkit.Chem as Chem
from scipy.sparse import csr_matrix
from scipy.sparse.csgraph import minimum_spanning_tree
from collections import defaultdict
from rdkit.Chem.EnumerateStereoisomers import EnumerateStereoisomers, StereoEnumerationOptions
from rdkit.Chem.Descriptors import MolLogP, qed
from torch_geometric.data import Data, Batch
from random import sample
from rdkit.Chem.rdForceFieldHelpers import UFFOptimizeMolecule
import numpy as np
from math import sqrt
import torch
from rdkit.Chem import BRICS
from copy import deepcopy
MST_MAX_WEIGHT = 100
MAX_NCAND = 2000
def vina_score(mol):
ligand_rdmol = Chem.AddHs(mol, addCoords=True)
if use_uff:
UFFOptimizeMolecule(ligand_rdmol)
def lipinski(mol):
if qed(mol)<=5 and Chem.Lipinski.NumHDonors(mol)<=5 and Chem.Lipinski.NumHAcceptors(mol)<=10 and Chem.Descriptors.ExactMolWt(mol)<=500 and Chem.Lipinski.NumRotatableBonds(mol)<=5:
return True
else:
return False
def list_filter(a,b):
filter = []
for i in a:
if i in b:
filter.append(i)
return filter
def rand_rotate(dir, ref, pos, alpha=None):
#dir = dir/torch.norm(dir)
if alpha is None:
alpha = torch.randn(1)
n_pos = pos.shape[0]
sin, cos = torch.sin(alpha), torch.cos(alpha)
K = 1 - cos
M = torch.dot(dir, ref)
nx, ny, nz = dir[0], dir[1], dir[2]
x0, y0, z0 = ref[0], ref[1], ref[2]
T = torch.tensor([nx ** 2 * K + cos, nx * ny * K - nz * sin, nx * nz * K + ny * sin,
(x0 - nx * M) * K + (nz * y0 - ny * z0) * sin,
nx * ny * K + nz * sin, ny ** 2 * K + cos, ny * nz * K - nx * sin,
(y0 - ny * M) * K + (nx * z0 - nz * x0) * sin,
nx * nz * K - ny * sin, ny * nz * K + nx * sin, nz ** 2 * K + cos,
(z0 - nz * M) * K + (ny * x0 - nx * y0) * sin,
0, 0, 0, 1]).reshape(4, 4)
pos = torch.cat([pos.t(), torch.ones(n_pos).unsqueeze(0)], dim=0)
rotated_pos = torch.mm(T, pos)[:3]
return rotated_pos.t()
def kabsch(A, B):
# Input:
# Nominal A Nx3 matrix of points
# Measured B Nx3 matrix of points
# Returns R,t
# R = 3x3 rotation matrix (B to A)
# t = 3x1 translation vector (B to A)
assert len(A) == len(B)
N = A.shape[0] # total points
centroid_A = np.mean(A, axis=0)
centroid_B = np.mean(B, axis=0)
# center the points
AA = A - np.tile(centroid_A, (N, 1))
BB = B - np.tile(centroid_B, (N, 1))
H = np.transpose(BB) * AA
U, S, Vt = np.linalg.svd(H)
R = Vt.T * U.T
# special reflection case
if np.linalg.det(R) < 0:
Vt[2, :] *= -1
R = Vt.T * U.T
t = -R * centroid_B.T + centroid_A.T
return R, t
def kabsch_torch(A, B, C):
A=A.double()
B=B.double()
C=C.double()
a_mean = A.mean(dim=0, keepdims=True)
b_mean = B.mean(dim=0, keepdims=True)
A_c = A - a_mean
B_c = B - b_mean
# Covariance matrix
H = torch.matmul(A_c.transpose(0,1), B_c) # [B, 3, 3]
U, S, V = torch.svd(H)
# Rotation matrix
R = torch.matmul(V, U.transpose(0,1)) # [B, 3, 3]
# Translation vector
t = b_mean - torch.matmul(R, a_mean.transpose(0,1)).transpose(0,1)
C_aligned = torch.matmul(R, C.transpose(0,1)).transpose(0,1) + t
return C_aligned, R, t
def eig_coord_from_dist(D):
M = (D[:1, :] + D[:, :1] - D) / 2
L, V = torch.linalg.eigh(M)
L = torch.diag_embed(L)
X = torch.matmul(V, L.clamp(min=0).sqrt())
return X[:, -3:].detach()
def self_square_dist(X):
dX = X.unsqueeze(0) - X.unsqueeze(1) # [1, N, 3] - [N, 1, 3]
D = torch.sum(dX**2, dim=-1)
return D
def set_atommap(mol, num=0):
for atom in mol.GetAtoms():
atom.SetAtomMapNum(num)
def get_mol(smiles):
mol = Chem.MolFromSmiles(smiles)
if mol is None:
return None
Chem.Kekulize(mol)
return mol
def get_smiles(mol):
return Chem.MolToSmiles(mol, kekuleSmiles=True)
def decode_stereo(smiles2D):
mol = Chem.MolFromSmiles(smiles2D)
dec_isomers = list(EnumerateStereoisomers(mol))
dec_isomers = [Chem.MolFromSmiles(Chem.MolToSmiles(mol, isomericSmiles=True)) for mol in dec_isomers]
smiles3D = [Chem.MolToSmiles(mol, isomericSmiles=True) for mol in dec_isomers]
chiralN = [atom.GetIdx() for atom in dec_isomers[0].GetAtoms() if
int(atom.GetChiralTag()) > 0 and atom.GetSymbol() == "N"]
if len(chiralN) > 0:
for mol in dec_isomers:
for idx in chiralN:
mol.GetAtomWithIdx(idx).SetChiralTag(Chem.rdchem.ChiralType.CHI_UNSPECIFIED)
smiles3D.append(Chem.MolToSmiles(mol, isomericSmiles=True))
return smiles3D
def sanitize(mol):
try:
smiles = get_smiles(mol)
mol = get_mol(smiles)
except Exception as e:
return None
return mol
def copy_atom(atom):
new_atom = Chem.Atom(atom.GetSymbol())
new_atom.SetFormalCharge(atom.GetFormalCharge())
new_atom.SetAtomMapNum(atom.GetAtomMapNum())
return new_atom
def copy_edit_mol(mol):
new_mol = Chem.RWMol(Chem.MolFromSmiles(''))
for atom in mol.GetAtoms():
new_atom = copy_atom(atom)
new_mol.AddAtom(new_atom)
for bond in mol.GetBonds():
a1 = bond.GetBeginAtom().GetIdx()
a2 = bond.GetEndAtom().GetIdx()
bt = bond.GetBondType()
new_mol.AddBond(a1, a2, bt)
return new_mol
def get_submol(mol, idxs, mark=[]):
new_mol = Chem.RWMol(Chem.MolFromSmiles(''))
map = {}
for atom in mol.GetAtoms():
if atom.GetIdx() in idxs:
new_atom = copy_atom(atom)
if atom.GetIdx() in mark:
new_atom.SetAtomMapNum(1)
else:
new_atom.SetAtomMapNum(0)
map[atom.GetIdx()] = new_mol.AddAtom(new_atom)
for bond in mol.GetBonds():
a1 = bond.GetBeginAtom().GetIdx()
a2 = bond.GetEndAtom().GetIdx()
if a1 in idxs and a2 in idxs:
bt = bond.GetBondType()
new_mol.AddBond(map[a1], map[a2], bt)
return new_mol.GetMol()
def get_clique_mol(mol, atoms):
smiles = Chem.MolFragmentToSmiles(mol, atoms, kekuleSmiles=True)
new_mol = Chem.MolFromSmiles(smiles, sanitize=False)
new_mol = copy_edit_mol(new_mol).GetMol()
new_mol = sanitize(new_mol) # We assume this is not None
return new_mol
def get_clique_mol_simple(mol, cluster):
smile_cluster = Chem.MolFragmentToSmiles(mol, cluster, canonical=True, kekuleSmiles=True)
mol_cluster = Chem.MolFromSmiles(smile_cluster, sanitize=False)
return mol_cluster
def tree_decomp(mol, reference_vocab=None):
edges = defaultdict(int)
n_atoms = mol.GetNumAtoms()
clusters = []
for bond in mol.GetBonds():
a1 = bond.GetBeginAtom().GetIdx()
a2 = bond.GetEndAtom().GetIdx()
if not bond.IsInRing():
clusters.append({a1, a2})
ssr = [set(x) for x in Chem.GetSymmSSSR(mol)]
# remove too large circles
ssr = [x for x in ssr if len(x) <= 8]
clusters.extend(ssr)
nei_list = [[] for _ in range(n_atoms)]
for i in range(len(clusters)):
for atom in clusters[i]:
nei_list[atom].append(i)
# Merge Rings with intersection > 2 atoms/ at least 3 joint atoms
# check the reference_vocab if it is not None
for i in range(len(clusters)):
if len(clusters[i]) <= 2:
continue
for atom in clusters[i]:
for j in nei_list[atom]:
if i >= j or len(clusters[j]) <= 2:
continue
inter = clusters[i] & clusters[j]
if len(inter) > 2:
merge = clusters[i] | clusters[j]
if reference_vocab is not None:
smile_merge = Chem.MolFragmentToSmiles(mol, merge, canonical=True, kekuleSmiles=True)
if reference_vocab[smile_merge] <= 99:
continue
clusters[i] = merge
clusters[j] = set()
clusters = [c for c in clusters if len(c) > 0]
nei_list = [[] for _ in range(n_atoms)]
for i in range(len(clusters)):
for atom in clusters[i]:
nei_list[atom].append(i)
# Build edges
for atom in range(n_atoms):
if len(nei_list[atom]) <= 1:
continue
cnei = nei_list[atom]
for i in range(len(cnei)):
for j in range(i + 1, len(cnei)):
c1, c2 = cnei[i], cnei[j]
inter = set(clusters[c1]) & set(clusters[c2])
if edges[(c1, c2)] < len(inter):
edges[(c1, c2)] = len(inter) # cnei[i] < cnei[j] by construction
edges = [u + (MST_MAX_WEIGHT - v,) for u, v in edges.items()]
if len(edges) == 0:
return clusters, edges
# Compute Maximum Spanning Tree
row, col, data = zip(*edges)
n_clique = len(clusters)
clique_graph = csr_matrix((data, (row, col)), shape=(n_clique, n_clique))
junc_tree = minimum_spanning_tree(clique_graph)
row, col = junc_tree.nonzero()
edges = [(row[i], col[i]) for i in range(len(row))]
return clusters, edges
def Brics_decomp(mol, reference_vocab=None):
edges = defaultdict(int)
n_atoms = mol.GetNumAtoms()
clusters = []
for bond in mol.GetBonds():
a1 = bond.GetBeginAtom().GetIdx()
a2 = bond.GetEndAtom().GetIdx()
if not bond.GetBeginAtom().IsInRing() and not bond.GetEndAtom().IsInRing():
clusters.append({a1, a2})
'''
bre = list(BRICS.FindBRICSBonds(mol))
if len(bre) != 0:
for bond in bre:
if [bond[0][0], bond[0][1]] in clusters:
clusters.remove([bond[0][0], bond[0][1]])
else:
clusters.remove([bond[0][1], bond[0][0]])
clusters.append([bond[0][0]])
clusters.append([bond[0][1]])'''
ssr = [set(x) for x in Chem.GetSymmSSSR(mol)]
# remove too large circles
ssr = [x for x in ssr if len(x) <= 8]
clusters.extend(ssr)
# merge clusters
for c in range(len(clusters) - 1):
if c >= len(clusters):
break
for k in range(c + 1, len(clusters)):
if k >= len(clusters):
break
if len(set(clusters[c]) & set(clusters[k])) > 1:
clusters[c] = list(set(clusters[c]) | set(clusters[k]))
clusters[k] = []
clusters = [c for c in clusters if len(c) > 0]
clusters = [c for c in clusters if len(c) > 0]
edges = [(0, 0)]
return clusters, edges
def atom_equal(a1, a2):
return a1.GetSymbol() == a2.GetSymbol() and a1.GetFormalCharge() == a2.GetFormalCharge()
# Bond type not considered because all aromatic (so SINGLE matches DOUBLE)
def ring_bond_equal(bond1, bond2, reverse=False):
b1 = (bond1.GetBeginAtom(), bond1.GetEndAtom())
if reverse:
b2 = (bond2.GetEndAtom(), bond2.GetBeginAtom())
else:
b2 = (bond2.GetBeginAtom(), bond2.GetEndAtom())
return atom_equal(b1[0], b2[0]) and atom_equal(b1[1], b2[1]) and bond1.GetBondType() == bond2.GetBondType()
def attach(ctr_mol, nei_mol, amap):
ctr_mol = Chem.RWMol(ctr_mol)
for atom in nei_mol.GetAtoms():
if atom.GetIdx() not in amap:
new_atom = copy_atom(atom)
new_atom.SetAtomMapNum(2)
amap[atom.GetIdx()] = ctr_mol.AddAtom(new_atom)
for bond in nei_mol.GetBonds():
a1 = amap[bond.GetBeginAtom().GetIdx()]
a2 = amap[bond.GetEndAtom().GetIdx()]
if ctr_mol.GetBondBetweenAtoms(a1, a2) is None:
ctr_mol.AddBond(a1, a2, bond.GetBondType())
return ctr_mol.GetMol(), amap
def attach_mols(ctr_mol, neighbors, prev_nodes, nei_amap):
prev_nids = [node.nid for node in prev_nodes]
for nei_node in prev_nodes + neighbors:
nei_id, nei_mol = nei_node.nid, nei_node.mol
amap = nei_amap[nei_id]
for atom in nei_mol.GetAtoms():
if atom.GetIdx() not in amap:
new_atom = copy_atom(atom)
amap[atom.GetIdx()] = ctr_mol.AddAtom(new_atom)
if nei_mol.GetNumBonds() == 0:
nei_atom = nei_mol.GetAtomWithIdx(0)
ctr_atom = ctr_mol.GetAtomWithIdx(amap[0])
ctr_atom.SetAtomMapNum(nei_atom.GetAtomMapNum())
else:
for bond in nei_mol.GetBonds():
a1 = amap[bond.GetBeginAtom().GetIdx()]
a2 = amap[bond.GetEndAtom().GetIdx()]
if ctr_mol.GetBondBetweenAtoms(a1, a2) is None:
ctr_mol.AddBond(a1, a2, bond.GetBondType())
elif nei_id in prev_nids: # father node overrides
ctr_mol.RemoveBond(a1, a2)
ctr_mol.AddBond(a1, a2, bond.GetBondType())
return ctr_mol
def local_attach(ctr_mol, neighbors, prev_nodes, amap_list):
ctr_mol = copy_edit_mol(ctr_mol)
nei_amap = {nei.nid: {} for nei in prev_nodes + neighbors}
for nei_id, ctr_atom, nei_atom in amap_list:
nei_amap[nei_id][nei_atom] = ctr_atom
ctr_mol = attach_mols(ctr_mol, neighbors, prev_nodes, nei_amap)
return ctr_mol.GetMol()
# This version records idx mapping between ctr_mol and nei_mol
def enum_attach(ctr_mol, nei_mol):
try:
Chem.Kekulize(ctr_mol)
Chem.Kekulize(nei_mol)
except:
return []
att_confs = []
valence_ctr = {i: 0 for i in range(ctr_mol.GetNumAtoms())}
valence_nei = {i: 0 for i in range(nei_mol.GetNumAtoms())}
ctr_bonds = [bond for bond in ctr_mol.GetBonds() if bond.GetBeginAtom().GetAtomMapNum() == 1 and bond.GetEndAtom().GetAtomMapNum() == 1]
ctr_atoms = [atom for atom in ctr_mol.GetAtoms() if atom.GetAtomMapNum() == 1]
if nei_mol.GetNumBonds() == 1: # neighbor is a bond
bond = nei_mol.GetBondWithIdx(0)
#bond_val = int(bond.GetBondType())
bond_val = int(bond.GetBondTypeAsDouble())
b1, b2 = bond.GetBeginAtom(), bond.GetEndAtom()
for atom in ctr_atoms:
# Optimize if atom is carbon (other atoms may change valence)
if atom.GetAtomicNum() == 6 and atom.GetTotalNumHs() < bond_val:
continue
if atom_equal(atom, b1):
new_amap = {b1.GetIdx(): atom.GetIdx()}
att_confs.append(new_amap)
elif atom_equal(atom, b2):
new_amap = {b2.GetIdx(): atom.GetIdx()}
att_confs.append(new_amap)
else:
# intersection is an atom
for a1 in ctr_atoms:
for a2 in nei_mol.GetAtoms():
if atom_equal(a1, a2):
# Optimize if atom is carbon (other atoms may change valence)
if a1.GetAtomicNum() == 6 and a1.GetTotalNumHs() + a2.GetTotalNumHs() < 4:
continue
amap = {a2.GetIdx(): a1.GetIdx()}
att_confs.append(amap)
# intersection is an bond
if ctr_mol.GetNumBonds() > 1:
for b1 in ctr_bonds:
for b2 in nei_mol.GetBonds():
if ring_bond_equal(b1, b2):
amap = {b2.GetBeginAtom().GetIdx(): b1.GetBeginAtom().GetIdx(),
b2.GetEndAtom().GetIdx(): b1.GetEndAtom().GetIdx()}
att_confs.append(amap)
if ring_bond_equal(b1, b2, reverse=True):
amap = {b2.GetEndAtom().GetIdx(): b1.GetBeginAtom().GetIdx(),
b2.GetBeginAtom().GetIdx(): b1.GetEndAtom().GetIdx()}
att_confs.append(amap)
return att_confs
def enumerate_assemble(mol, idxs, current, next):
ctr_mol = get_submol(mol, idxs, mark=current.clique)
ground_truth = get_submol(mol, list(set(idxs) | set(next.clique)))
# submol can also obtained with get_clique_mol, future exploration
ground_truth_smiles = get_smiles(ground_truth)
cand_smiles = []
cand_mols = []
cand_amap = enum_attach(ctr_mol, next.mol)
for amap in cand_amap:
try:
cand_mol, _ = attach(ctr_mol, next.mol, amap)
cand_mol = sanitize(cand_mol)
except:
continue
if cand_mol is None:
continue
smiles = get_smiles(cand_mol)
if smiles in cand_smiles or smiles == ground_truth_smiles:
continue
cand_smiles.append(smiles)
cand_mols.append(cand_mol)
if len(cand_mols) >= 1:
cand_mols = sample(cand_mols, 1)
cand_mols.append(ground_truth)
labels = torch.tensor([0, 1])
else:
cand_mols = [ground_truth]
labels = torch.tensor([1])
return labels, cand_mols
# allowable node and edge features
allowable_features = {
'possible_atomic_num_list' : list(range(1, 119)),
'possible_formal_charge_list' : [-5, -4, -3, -2, -1, 0, 1, 2, 3, 4, 5],
'possible_chirality_list' : [
Chem.rdchem.ChiralType.CHI_UNSPECIFIED,
Chem.rdchem.ChiralType.CHI_TETRAHEDRAL_CW,
Chem.rdchem.ChiralType.CHI_TETRAHEDRAL_CCW,
Chem.rdchem.ChiralType.CHI_OTHER
],
'possible_hybridization_list' : [
Chem.rdchem.HybridizationType.S,
Chem.rdchem.HybridizationType.SP, Chem.rdchem.HybridizationType.SP2,
Chem.rdchem.HybridizationType.SP3, Chem.rdchem.HybridizationType.SP3D,
Chem.rdchem.HybridizationType.SP3D2, Chem.rdchem.HybridizationType.UNSPECIFIED
],
'possible_numH_list' : [0, 1, 2, 3, 4, 5, 6, 7, 8],
'possible_implicit_valence_list' : [0, 1, 2, 3, 4, 5, 6],
'possible_degree_list' : [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10],
'possible_bonds' : [
Chem.rdchem.BondType.SINGLE,
Chem.rdchem.BondType.DOUBLE,
Chem.rdchem.BondType.TRIPLE,
Chem.rdchem.BondType.AROMATIC
],
'possible_bond_dirs' : [ # only for double bond stereo information
Chem.rdchem.BondDir.NONE,
Chem.rdchem.BondDir.ENDUPRIGHT,
Chem.rdchem.BondDir.ENDDOWNRIGHT
]
}
def mol_to_graph_data_obj_simple(mol):
"""
Converts rdkit mol object to graph Data object required by the pytorch
geometric package. NB: Uses simplified atom and bond features, and represent
as indices
:param mol: rdkit mol object
:return: graph data object with the attributes: x, edge_index, edge_attr
"""
# atoms
num_atom_features = 2 # atom type, chirality tag
atom_features_list = []
for atom in mol.GetAtoms():
atom_feature = [allowable_features['possible_atomic_num_list'].index(
atom.GetAtomicNum())] + [allowable_features[
'possible_chirality_list'].index(atom.GetChiralTag())]
atom_features_list.append(atom_feature)
x = torch.tensor(np.array(atom_features_list), dtype=torch.long)
# bonds
num_bond_features = 2 # bond type, bond direction
if len(mol.GetBonds()) > 0: # mol has bonds
edges_list = []
edge_features_list = []
for bond in mol.GetBonds():
i = bond.GetBeginAtomIdx()
j = bond.GetEndAtomIdx()
edge_feature = [allowable_features['possible_bonds'].index(
bond.GetBondType())] + [allowable_features[
'possible_bond_dirs'].index(
bond.GetBondDir())]
edges_list.append((i, j))
edge_features_list.append(edge_feature)
edges_list.append((j, i))
edge_features_list.append(edge_feature)
# data.edge_index: Graph connectivity in COO format with shape [2, num_edges]
edge_index = torch.tensor(np.array(edges_list).T, dtype=torch.long)
# data.edge_attr: Edge feature matrix with shape [num_edges, num_edge_features]
edge_attr = torch.tensor(np.array(edge_features_list),
dtype=torch.long)
else: # mol has no bonds
edge_index = torch.empty((2, 0), dtype=torch.long)
edge_attr = torch.empty((0, num_bond_features), dtype=torch.long)
data = Data(x=x, edge_index=edge_index, edge_attr=edge_attr)
return data
# For inference
def assemble(mol_list, next_motif_smiles):
attach_fail = torch.zeros(len(mol_list)).bool()
cand_mols, cand_batch, new_atoms, cand_smiles, one_atom_attach, intersection = [], [], [], [], [], []
for i in range(len(mol_list)):
next = Chem.MolFromSmiles(next_motif_smiles[i])
cand_amap = enum_attach(mol_list[i], next)
if len(cand_amap) == 0:
attach_fail[i] = True
cand_mols.append(mol_list[i])
cand_batch.append(i)
one_atom_attach.append(-1)
intersection.append([])
new_atoms.append([])
else:
valid_cand = 0
for amap in cand_amap:
amap_len = len(amap)
iter_atoms = [v for v in amap.values()]
ctr_mol = deepcopy(mol_list[i])
cand_mol, amap1 = attach(ctr_mol, next, amap)
if sanitize(deepcopy(cand_mol)) is None:
continue
smiles = get_smiles(cand_mol)
cand_smiles.append(smiles)
cand_mols.append(cand_mol)
cand_batch.append(i)
new_atoms.append([v for v in amap1.values()])
one_atom_attach.append(amap_len)
intersection.append(iter_atoms)
valid_cand+=1
if valid_cand==0:
attach_fail[i] = True
cand_mols.append(mol_list[i])
cand_batch.append(i)
one_atom_attach.append(-1)
intersection.append([])
new_atoms.append([])
cand_batch = torch.tensor(cand_batch)
one_atom_attach = torch.tensor(one_atom_attach) == 1
return cand_mols, cand_batch, new_atoms, one_atom_attach, intersection, attach_fail
if __name__ == "__main__":
import sys
from mol_tree import MolTree
lg = rdkit.RDLogger.logger()
lg.setLevel(rdkit.RDLogger.CRITICAL)
smiles = ["O=C1[C@@H]2C=C[C@@H](C=CC2)C1(c1ccccc1)c1ccccc1", "O=C([O-])CC[C@@]12CCCC[C@]1(O)OC(=O)CC2",
"ON=C1C[C@H]2CC3(C[C@@H](C1)c1ccccc12)OCCO3",
"C[C@H]1CC(=O)[C@H]2[C@@]3(O)C(=O)c4cccc(O)c4[C@@H]4O[C@@]43[C@@H](O)C[C@]2(O)C1",
'Cc1cc(NC(=O)CSc2nnc3c4ccccc4n(C)c3n2)ccc1Br', 'CC(C)(C)c1ccc(C(=O)N[C@H]2CCN3CCCc4cccc2c43)cc1',
"O=c1c2ccc3c(=O)n(-c4nccs4)c(=O)c4ccc(c(=O)n1-c1nccs1)c2c34", "O=C(N1CCc2c(F)ccc(F)c2C1)C1(O)Cc2ccccc2C1"]
mol_tree = MolTree("C")
assert len(mol_tree.nodes) > 0
def count():
cnt, n = 0, 0
for s in sys.stdin:
s = s.split()[0]
tree = MolTree(s)
tree.recover()
tree.assemble()
for node in tree.nodes:
cnt += len(node.cands)
n += len(tree.nodes)
# print cnt * 1.0 / n
count()
|